![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
![[ ]](/icons/world2.gif){kind=icon}
![[TXT]](/icons/text.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| A mosquito_repel_DEET.gif | 2010-12-31 09:20 | 40K | |
| CITRON.CW2 | 2010-12-31 16:12 | 49K | |
| DEET-Insect-Repellents.jpg | 2010-12-31 15:28 | 22K | |
| DEET - Molecule of the Month - January 2011.pdf | 2017-07-28 11:49 | 317K | |
| DEET-cartoon.gif | 2010-12-31 15:58 | 40K | |
| DEET.CW2 | 2010-12-31 09:14 | 95K | |
| DEET1.CW2 | 2010-12-31 15:06 | 60K | |
| DEET1.MOL | 2010-12-31 15:07 | 1.2K | |
| INDALONE.CW2 | 2010-12-31 16:07 | 95K | |
| RUTGERS.CW2 | 2010-12-31 16:02 | 53K | |
| TOLUIC.CW2 | 2010-12-31 15:05 | 38K | |
| TOLUICCL.CW2 | 2010-12-31 15:05 | 36K | |
| arrow1.gif | 2010-10-19 14:46 | 269 | |
| c2h5.gif | 2010-12-31 15:27 | 372 | |
| citronellal.gif | 2010-12-31 16:15 | 508 | |
| citronellal.mol | 2011-01-05 09:21 | 2.4K | |
| citronellal.wrl | 2011-01-05 09:21 | 7.3K | |
| deet-sf.gif | 2010-12-31 15:48 | 5.2K | |
| deet.gif | 2010-12-31 09:15 | 795 | |
| deet.jpg | 2010-12-31 09:19 | 268K | |
| deet.mol | 2011-01-05 09:22 | 2.6K | |
| deet.wrl | 2011-01-05 09:22 | 8.3K | |
| deet1.gif | 2010-12-31 15:10 | 584 | |
| deetc.htm | 2011-01-17 14:18 | 10K | |
| deetcan.gif | 2010-12-31 15:43 | 71K | |
| deeth.htm | 2017-07-28 11:49 | 9.3K | |
| deetjm.htm | 2011-01-17 14:18 | 12K | |
| deetjs.htm | 2017-07-23 14:12 | 16K | |
| deetv.htm | 2011-01-17 14:18 | 9.5K | |
| dmp.gif | 2010-12-31 16:16 | 619 | |
| dmp.mol | 2011-01-05 09:22 | 2.1K | |
| dmp.wrl | 2011-01-05 09:22 | 7.0K | |
| dmpt.CW2 | 2010-12-31 16:05 | 58K | |
| face.gif | 2010-12-31 15:30 | 39K | |
| hands.jpg | 2010-12-31 09:22 | 23K | |
| indalone.gif | 2010-12-31 16:16 | 727 | |
| indalone.mol | 2011-01-05 09:23 | 2.9K | |
| indalone.wrl | 2011-01-05 09:23 | 8.8K | |
| ink.css | 2010-10-19 11:42 | 107 | |
| mosquito-sign.gif | 2010-12-31 15:37 | 14K | |
| mosquito.jpg | 2010-12-31 09:20 | 61K | |
| mosquito_biting_human.jpg | 2010-12-31 15:56 | 19K | |
| mosquitoes_biting_human.jpg | 2010-12-31 09:20 | 71K | |
| picture-1.png | 2010-12-31 09:21 | 131K | |
| pwm-deet.css | 2017-03-16 13:11 | 1.6K | |
| pwm.css | 2010-10-19 11:43 | 972 | |
| rutgers.gif | 2010-12-31 16:16 | 483 | |
| rutgers.mol | 2011-01-05 09:23 | 2.4K | |
| rutgers.wrl | 2011-01-05 09:23 | 6.6K | |
| socl2.gif | 2010-12-31 15:10 | 232 | |
| toluic.gif | 2010-12-31 15:10 | 480 | |
| toluic.mol | 2011-01-05 09:24 | 1.6K | |
| toluic.wrl | 2011-01-05 09:24 | 5.5K | |
| toluiccl.gif | 2010-12-31 15:10 | 462 | |
| toluiccl.mol | 2011-01-05 09:25 | 1.5K | |
| toluiccl.wrl | 2011-01-05 09:25 | 5.2K | |