![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
![[TXT]](/icons/text.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| relaxed-dog.jpg | 2015-06-22 16:23 | 37K | |
| pwm.css | 2014-06-25 13:07 | 972 | |
| pwm-gaba.css | 2016-03-23 16:38 | 1.4K | |
| gabajs.htm | 2017-04-06 16:23 | 8.1K | |
| gabajm.htm | 2015-06-22 16:44 | 7.0K | |
| gabah.htm | 2017-09-12 13:41 | 6.7K | |
| gaba2.jpg | 2015-06-22 15:34 | 28K | |
| gaba1.jpg | 2015-06-22 15:31 | 48K | |
| gaba1.gif | 2015-06-22 15:41 | 8.3K | |
| gaba.mol | 2015-06-22 16:28 | 1.5K | |
| gaba.gif | 2015-06-22 15:35 | 3.1K | |
| gaba-bottle.jpg | 2015-06-22 15:25 | 38K | |
| gaba-bottle.gif | 2015-06-22 15:27 | 62K | |
| coffee.jpg | 2015-06-22 15:29 | 19K | |
| Gamma-aminobutyric acid (GABA) Molecule of the Month - July 2015.pdf | 2017-09-12 13:42 | 274K | |
| GABA molecule.docx | 2015-06-22 11:55 | 617K | |