![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
![[ ]](/icons/world2.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
![[TXT]](/icons/text.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| Ibogaine - Molecule of the Month - September 2002.pdf | 2017-09-26 22:05 | 305K | |
| 18mc.wrl | 2002-06-12 11:14 | 136K | |
| ibogaine.wrl | 2002-05-21 13:28 | 120K | |
| 18mc.gif | 2002-06-12 10:20 | 66K | |
| motm-iboga.jpg | 2002-05-21 10:01 | 34K | |
| howard.jpg | 2002-05-21 11:23 | 16K | |
| ibogainejm.htm | 2014-10-23 10:03 | 12K | |
| ibogainej.htm | 2010-01-22 10:13 | 12K | |
| ibogainec.htm | 2014-10-23 10:00 | 11K | |
| ibogaine.htm | 2017-09-26 22:04 | 11K | |
| ibogainev.htm | 2014-10-23 10:00 | 11K | |
| Thumbs.db | 2005-04-14 09:55 | 7.5K | |
| ibo.gif | 2002-05-21 11:15 | 5.6K | |
| 18mc.mol | 2002-06-12 10:39 | 5.1K | |
| heroin.jpg | 2002-05-21 13:05 | 4.7K | |
| ibogaine.mol | 2002-05-21 11:13 | 4.4K | |
| ibogaine.pdb | 2002-05-21 11:11 | 2.4K | |
| motm-ibogaine.gif | 2002-05-21 10:01 | 2.0K | |
| motm-ibogaine.cdx | 2002-05-21 10:01 | 1.7K | |