![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
![[TXT]](/icons/text.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| Mustard Gas - Molecule of the Month - June 1998.pdf | 2017-08-03 13:42 | 165K | |
| Thumbs.db | 2005-04-14 09:55 | 6.0K | |
| m1.gif | 1998-05-28 13:13 | 5.5K | |
| must2.gif | 1998-05-28 13:31 | 1.6K | |
| mustard.gif | 1998-05-28 13:13 | 14K | |
| mustard.htm | 2017-08-03 13:41 | 10K | |
| mustard.mol | 1998-05-28 13:13 | 1.3K | |
| mustard1.htm | 2014-10-23 12:24 | 10K | |
| mustard2.gif | 1998-05-28 13:13 | 1.9K | |
| mustard2.htm | 2014-10-23 12:27 | 11K | |
| mustard3.gif | 1998-05-28 13:13 | 511 | |
| mustardjs.htm | 2017-08-03 13:38 | 13K | |
| musttitle.gif | 1998-05-28 13:13 | 4.1K | |
| nmust2.gif | 1998-05-28 13:31 | 1.5K | |
| nmustard.mol | 1998-05-28 13:32 | 1.3K | |