![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
![[TXT]](/icons/text.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| PROSTAN.CW2 | 2006-08-31 13:26 | 80K | |
| Pnicogen - Molecule of the Month - June 2003.pdf | 2017-09-25 15:29 | 242K | |
| Thumbs.db | 2005-04-14 09:49 | 7.5K | |
| holger.jpg | 2003-05-06 10:26 | 84K | |
| jeitschko.jpg | 2003-05-06 10:25 | 5.1K | |
| kana.jpg | 2003-05-06 10:29 | 214K | |
| kauzlar.jpg | 2003-05-06 10:19 | 66K | |
| mar.jpg | 2003-05-06 10:16 | 18K | |
| pnic1.jpg | 2003-05-06 15:36 | 11K | |
| pnictide0210.jpg | 2003-05-06 14:39 | 23K | |
| pnictogenh.htm | 2017-09-25 15:28 | 17K | |
| schraube.jpg | 2003-05-06 15:28 | 34K | |
| tcm.gif | 2003-05-06 15:16 | 11K | |
| teg.gif | 2003-05-06 17:08 | 4.2K | |
