![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
.jpg){kind=link}
![[TXT]](/icons/text.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| Thumbs.db | 2005-04-14 09:49 | 6.0K | |
| WATER - Molecule of the Month - October 1996.pdf | 2017-10-04 16:45 | 304K | |
| cp.jpg | 1997-06-12 09:50 | 26K | |
| dgr.jpg | 1997-06-12 09:50 | 30K | |
| diel.jpg | 1997-06-12 10:02 | 20K | |
| eq.jpg | 1997-06-12 09:50 | 17K | |
| g(r).jpg | 1997-06-12 09:50 | 16K | |
| molvol.jpg | 1997-06-12 10:02 | 16K | |
| water.gif | 1997-06-12 09:50 | 7.7K | |
| water.htm | 2017-10-04 16:45 | 17K | |