![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
![[ ]](/icons/world2.gif){kind=icon}
![[TXT]](/icons/text.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 1976_kornelia_ender.gif | 2010-03-16 10:22 | 42K | |
| 1976_kornelia_ender.jpg | 2010-03-16 10:19 | 534K | |
| Barry-Bonds JPG.jpg | 2010-03-01 08:55 | 29K | |
| Barry Bonds wiki commons.jpg | 2010-03-01 08:55 | 1.0M | |
| Don-Catlin.gif | 2010-03-16 10:00 | 32K | |
| Don Catlin.jpg | 2010-03-01 08:55 | 186K | |
| Dwain_Chambers, wikipedia commons.jpg | 2010-03-01 08:55 | 2.7M | |
| Dwain_Chambers-wikimedia.gif | 2010-03-16 10:05 | 49K | |
| Dwain_Chambers wikimedia.jpg | 2010-03-01 08:55 | 45K | |
| MOTM TETRAHYDROGESTRINONE.doc | 2010-03-01 08:55 | 255K | |
| Marion-Jones.gif | 2010-03-16 09:54 | 78K | |
| Marion Jones.jpg | 2010-03-01 08:55 | 28K | |
| Marion Jones 2.jpg | 2010-03-01 08:55 | 77K | |
| Patrick Arnold.bmp | 2010-03-01 08:55 | 215K | |
| THG - - Molecule of the Month - August 2010.pdf | 2017-07-28 11:21 | 426K | |
| THG-sf.gif | 2010-03-16 12:10 | 13K | |
| THG.mol | 2010-03-16 11:59 | 4.3K | |
| THG.wrl | 2010-03-16 12:20 | 14K | |
| THGc.htm | 2010-03-22 11:20 | 20K | |
| THGh.htm | 2017-07-28 11:19 | 19K | |
| THGjm.htm | 2010-03-22 11:26 | 23K | |
| THGjs.htm | 2017-06-23 16:00 | 32K | |
| THGv.htm | 2010-03-22 11:11 | 19K | |
| Victor-conte.gif | 2010-03-16 09:58 | 51K | |
| Victor-conte.jpg | 2010-03-01 08:55 | 40K | |
| andro.gif | 2017-06-23 15:34 | 2.7K | |
| andro.mol | 2010-03-16 11:51 | 4.1K | |
| andro.wrl | 2010-03-16 12:21 | 13K | |
| asteroid.gif | 2010-03-15 16:32 | 20K | |
| dianabol.gif | 2017-06-23 15:36 | 3.0K | |
| dianabol.mol | 2010-03-16 11:49 | 4.2K | |
| dianabol.wrl | 2010-03-16 12:21 | 13K | |
| furazabol.gif | 2017-06-23 15:39 | 2.9K | |
| furazabol.mol | 2010-03-16 11:56 | 4.6K | |
| furazabol.wrl | 2010-03-16 12:21 | 14K | |
| gestrinone.mol | 2010-03-16 12:13 | 4.0K | |
| gestrinone.wrl | 2010-03-16 12:18 | 13K | |
| ink.css | 2010-03-15 16:06 | 107 | |
| madol.gif | 2017-06-23 15:41 | 2.8K | |
| madol.mol | 2010-03-16 12:04 | 4.5K | |
| madol.wrl | 2010-03-16 12:21 | 14K | |
| nandrolone.gif | 2017-06-23 15:39 | 2.7K | |
| nandrolone.mol | 2010-03-16 11:53 | 3.9K | |
| nandrolone.wrl | 2010-03-16 12:21 | 12K | |
| norbolethone.gif | 2017-06-23 15:42 | 2.9K | |
| norbolethone.mol | 2010-03-16 11:57 | 4.6K | |
| norbolethone.wrl | 2010-03-16 12:20 | 14K | |
| pwm-thg.css | 2017-06-23 15:04 | 1.4K | |
| pwm.css | 2010-03-15 16:06 | 972 | |
| reaction.gif | 2010-03-15 17:01 | 2.9K | |
| reaction2.gif | 2010-03-15 17:08 | 4.1K | |
| stanozolol.gif | 2017-06-23 15:38 | 2.9K | |
| stanozolol.mol | 2010-03-16 11:45 | 4.7K | |
| stanozolol.wrl | 2010-03-16 12:20 | 15K | |
| steroid.gif | 2010-03-15 16:35 | 1.2K | |
| testand.gif | 2010-03-15 16:38 | 2.1K | |
| testosterone.gif | 2017-06-23 15:33 | 2.6K | |
| testosterone.mol | 2010-03-16 11:51 | 4.2K | |
| testosterone.wrl | 2010-03-16 12:20 | 13K | |
| thg.gif | 2017-06-23 15:41 | 3.0K | |
| turinabol.gif | 2017-06-23 15:37 | 3.1K | |
| turinabol.mol | 2010-03-16 11:49 | 4.2K | |
| turinabol.wrl | 2010-03-16 12:19 | 13K | |