![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[TXT]](/icons/text.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| acrolein.mol | 2016-06-03 17:55 | 793 | |
| acrylamide.mol | 2016-08-04 14:19 | 1.0K | |
| pwm-acrylamide.css | 2016-05-19 09:47 | 1.4K | |
| arrow.gif | 2016-05-20 17:46 | 1.6K | |
| acrolein.gif | 2016-06-03 17:49 | 2.5K | |
| acrylamide.gif | 2016-08-04 14:16 | 2.8K | |
| glycidamide.gif | 2016-06-03 17:42 | 4.2K | |
| polyacrylamide.gif | 2016-06-03 17:34 | 7.6K | |
| graph.gif | 2016-06-07 11:51 | 11K | |
| acrylamideh.htm | 2017-07-31 11:52 | 18K | |
| acrylamidejs.htm | 2017-04-06 16:15 | 21K | |
| synthesis.gif | 2016-06-03 17:48 | 22K | |
| chips.jpg | 2016-06-01 11:01 | 32K | |
| roast-pots.jpg | 2016-06-01 11:02 | 33K | |
| tunnel.gif | 2016-06-03 17:50 | 34K | |
| gel.jpg | 2016-06-07 12:34 | 40K | |
| ok-turkey.jpg | 2016-06-07 12:42 | 47K | |
| crisps.jpg | 2016-06-01 11:03 | 47K | |
| tunnel.jpg | 2016-06-01 11:07 | 50K | |
| burnt-turkey.jpg | 2016-06-07 12:41 | 65K | |
| deep-fat-frying.jpg | 2016-06-07 12:26 | 65K | |
| ACRYLAMIDE MOTM draft.doc | 2016-05-18 16:36 | 266K | |
| Acrylamide - Molecule of the Month - August 2016.pdf | 2017-07-31 11:54 | 642K | |