![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
![[TXT]](/icons/text.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| Sodium Hypochlorite - Molecule of the Month October 2011.pdf | 2017-07-28 15:16 | 223K | |
| ambulance.jpg | 2011-08-23 15:02 | 41K | |
| sheets.gif | 2011-08-23 14:55 | 26K | |
| berthollet.gif | 2011-08-23 14:24 | 16K | |
| bleachh.htm | 2017-07-28 15:15 | 11K | |
| clorox.gif | 2011-08-23 14:18 | 10K | |
| swimming-pool.jpg | 2011-08-23 14:22 | 9.5K | |
| javel.gif | 2011-08-23 14:32 | 7.9K | |
| javel1.gif | 2011-08-23 14:41 | 7.6K | |
| NaOCl-solution.jpg | 2011-08-23 14:28 | 6.4K | |
| NaOCl-powder.jpg | 2011-08-23 14:27 | 4.4K | |
| NaOCl.gif | 2011-08-23 14:21 | 3.1K | |
| pwm-bleach.css | 2017-02-27 13:43 | 1.4K | |
| pwm.css | 2010-10-19 11:43 | 972 | |
| ink.css | 2010-10-19 11:42 | 107 | |
| equil.gif | 2011-08-23 14:52 | 91 | |
| arrow.gif | 2002-08-22 11:10 | 67 | |
