![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
![[TXT]](/icons/text.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| Lutein and Zeaxanthin - Molecule of the Month June 2007.pdf | 2017-09-21 16:45 | 1.2M | |
| bacteriorhodopsin.htm | 2007-06-18 23:09 | 1.1K | |
| bacteriorhodopsin.html | 2007-05-09 09:33 | 1.0K | |
| carotenoids.htm | 2018-06-02 00:01 | 53K | |
| ccarotenoids.htm | 2018-06-02 00:01 | 55K | |
| images/ | 2007-10-04 12:43 | - | |
| jcarotenoids.htm | 2018-06-02 00:01 | 58K | |
| jlhcp.htm | 2007-06-19 21:58 | 817 | |
| jzeaxanthin.htm | 2007-06-19 21:56 | 451 | |
| lhcp.html | 2007-06-18 23:00 | 2.4K | |
| mol/ | 2007-05-31 09:04 | - | |
| pdb/ | 2007-06-19 08:49 | - | |
| zeaxanthin.htm | 2007-06-18 23:07 | 197 | |