![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[TXT]](/icons/text.gif){kind=icon}
![[ ]](/icons/world2.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| miller-expt.bmp | 2009-12-15 14:53 | 1.5M | |
| Miller-Science-1953.pdf | 2009-12-15 13:55 | 869K | |
| Glycine - Molecule of the Month - April 2010.pdf | 2017-07-28 11:12 | 207K | |
| motm GLYCINE.doc | 2009-12-15 13:55 | 168K | |
| TRANS.CW2 | 2009-12-15 15:29 | 136K | |
| CIS.CW2 | 2009-12-15 15:31 | 124K | |
| millerexpt.gif | 2009-12-15 14:57 | 60K | |
| GLYCINE.CW2 | 2009-12-15 15:11 | 28K | |
| glycinejs.htm | 2017-06-30 16:15 | 22K | |
| glycinejm.htm | 2010-03-31 09:59 | 20K | |
| glycinec.htm | 2010-03-31 09:59 | 19K | |
| glycinev.htm | 2010-03-31 09:59 | 19K | |
| glycineh.htm | 2017-07-28 11:11 | 19K | |
| stardust.jpg | 2009-12-15 15:00 | 17K | |
| glycine.jpg | 2009-12-15 16:23 | 8.0K | |
| trans.wrl | 2009-12-15 16:29 | 5.5K | |
| cis.wrl | 2009-12-15 16:30 | 5.5K | |
| zwitterion-ph.gif | 2009-12-15 14:48 | 4.3K | |
| trans-cis.gif | 2009-12-15 15:04 | 4.1K | |
| peptide.gif | 2009-12-15 14:49 | 3.4K | |
| glycine.wrl | 2009-12-15 16:30 | 3.0K | |
| zwitterion.gif | 2009-12-15 16:28 | 2.9K | |
| dipeptide.gif | 2009-12-15 14:51 | 2.6K | |
| trans1.gif | 2009-12-15 15:36 | 2.3K | |
| TRANS.GIF | 2009-12-15 15:29 | 2.3K | |
| CIS.GIF | 2009-12-15 15:31 | 2.3K | |
| cis1.gif | 2009-12-15 15:35 | 2.2K | |
| clrline-green.gif | 2016-06-13 11:27 | 2.2K | |
| trans.mol | 2009-12-15 16:29 | 1.5K | |
| cis.mol | 2009-12-15 16:29 | 1.5K | |
| pwm-glycine.css | 2017-06-30 00:18 | 1.4K | |
| pwm.css | 2009-12-15 14:01 | 972 | |
| glycine.gif | 2009-12-15 15:09 | 814 | |
| glycine.mol | 2009-12-15 16:19 | 811 | |
| ink.css | 2009-12-15 14:01 | 107 | |
| arrow.gif | 2002-08-22 11:10 | 67 | |
