![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
![[TXT]](/icons/text.gif){kind=icon}
![[ ]](/icons/world2.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| yaabaa.gif | 2006-11-01 12:16 | 18K | |
| vicks.gif | 2006-10-26 14:46 | 17K | |
| speedkills.gif | 2006-11-01 11:49 | 38K | |
| smallfaces.jpg | 2006-11-01 11:51 | 34K | |
| smallfaces.gif | 2006-11-01 11:51 | 95K | |
| simpson.jpg | 2006-11-01 11:57 | 6.2K | |
| simpson.gif | 2006-11-01 11:58 | 15K | |
| pwm.css | 2006-10-26 13:34 | 972 | |
| pwm-meth.css | 2017-07-07 10:59 | 1.4K | |
| phenylethylamine.wrl | 2007-01-23 13:24 | 39K | |
| phenylethylamine.mol | 2006-11-01 11:38 | 1.8K | |
| phenylethylamine.gif | 2006-11-01 11:38 | 617 | |
| phenylacetone.wrl | 2007-01-23 13:25 | 40K | |
| phenylacetone.mol | 2006-11-01 11:35 | 1.8K | |
| phenylacetone.gif | 2006-11-01 11:24 | 433 | |
| methv.htm | 2009-04-01 12:49 | 26K | |
| methjs.htm | 2020-06-25 10:25 | 41K | |
| methjm.htm | 2009-04-01 12:49 | 30K | |
| methh.htm | 2020-06-25 10:25 | 26K | |
| methc.htm | 2009-04-01 12:49 | 28K | |
| meth.gif | 2006-11-01 12:10 | 31K | |
| longarrow.gif | 2006-10-26 16:14 | 111 | |
| lmeth.wrl | 2007-01-23 13:26 | 50K | |
| lmeth.mol | 2006-10-26 14:54 | 2.3K | |
| lmeth.gif | 2006-11-06 09:43 | 1.0K | |
| ink.css | 2006-10-26 13:34 | 107 | |
| glucosejm.htm | 2007-03-06 16:29 | 21K | |
| friendlyfire.gif | 2006-11-01 11:46 | 55K | |
| fatfreddy.gif | 2006-11-01 11:56 | 104K | |
| fameth.wrl | 2007-01-23 13:25 | 54K | |
| fameth.mol | 2006-11-01 11:34 | 2.4K | |
| fameth.gif | 2006-11-01 11:24 | 764 | |
| ephedrine.wrl | 2007-01-23 13:26 | 52K | |
| ephedrine.mol | 2006-10-26 16:20 | 2.3K | |
| ephedrine.gif | 2006-10-26 16:13 | 1.0K | |
| dopamine.wrl | 2007-01-23 13:25 | 43K | |
| dopamine.mol | 2006-11-01 11:34 | 1.9K | |
| dopamine.gif | 2006-11-01 11:31 | 664 | |
| dmeth.wrl | 2007-01-23 13:26 | 50K | |
| dmeth.mol | 2006-10-26 14:53 | 2.3K | |
| dmeth.gif | 2006-11-06 09:42 | 1.0K | |
| crystalmeth.jpg | 2006-11-01 12:13 | 13K | |
| crystalmeth.gif | 2006-11-01 12:14 | 28K | |
| baxter.gif | 2006-10-26 14:37 | 50K | |
| arrow2.gif | 2006-11-01 11:29 | 185 | |
| arrow1.gif | 2006-11-01 11:28 | 229 | |
| amphetamine.wrl | 2007-01-23 13:24 | 44K | |
| amphetamine.mol | 2006-11-01 12:33 | 2.0K | |
| amphetamine.gif | 2006-11-01 12:34 | 1.0K | |
| RTRTC56.jpg | 2007-02-27 12:59 | 62K | |
| PHENYLE.CW2 | 2006-11-01 11:37 | 61K | |
| PHENYLA.CW2 | 2006-11-01 11:23 | 34K | |
| Methamphetamine - Molecule of the Month - March 2007.pdf | 2017-07-27 10:25 | 637K | |
| MOTM-METHAMPHETAMINE.doc | 2006-10-26 12:17 | 614K | |
| LMETH.CW2 | 2006-10-26 14:52 | 87K | |
| FAMETH.CW2 | 2006-11-01 11:21 | 66K | |
| EPHEDRIN.CW2 | 2006-10-26 16:11 | 59K | |
| DOPAMIN.CW2 | 2006-11-01 11:31 | 61K | |
| DMETH.CW2 | 2006-10-26 14:51 | 58K | |
| AMPH.CW2 | 2006-11-01 12:25 | 80K | |