![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
![[ ]](/icons/world2.gif){kind=icon}
![[TXT]](/icons/text.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| OSO4.CW2 | 2004-04-19 17:10 | 17K | |
| OsO4 - Molecule of the Month - May 2004.pdf | 2017-09-25 14:51 | 220K | |
| Thumbs.db | 2005-04-14 09:49 | 7.0K | |
| addition.gif | 2004-04-19 17:11 | 2.5K | |
| arrow.gif | 2001-03-16 10:14 | 67 | |
| osex.gif | 2004-04-19 17:11 | 1.8K | |
| oso4.gif | 2004-04-19 17:11 | 267 | |
| oso4.jpg | 2004-04-19 17:20 | 16K | |
| oso4.mol | 2004-04-19 17:14 | 516 | |
| oso4.wrl | 2004-04-20 16:49 | 15K | |
| oso4_big.gif | 2004-04-19 17:15 | 8.3K | |
| oso4c.htm | 2005-11-02 09:13 | 9.8K | |
| oso4h.htm | 2017-09-25 14:50 | 10K | |
| oso4jm.htm | 2005-11-02 09:13 | 10K | |
| oso4v.htm | 2005-11-02 09:13 | 9.8K | |