![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/world2.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
![[TXT]](/icons/text.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| serotonin.wrl | 2005-01-14 14:32 | 200 | |
| Thumbs.db | 2005-04-14 09:49 | 214 | |
| SYNTHE1.GIF | 2017-09-25 13:30 | 437 | |
| lsd.ht3.jpg | 2017-09-25 13:30 | 438 | |
| DEPRES2.GIF | 2017-09-25 13:30 | 437 | |
| Page_11.gif | 2017-09-25 13:30 | 438 | |
| SEROTO2.GIF | 2017-09-25 13:30 | 465 | |
| serotoninh.htm | 2017-09-25 13:39 | 2.0K | |
| Serotonin Molecule of the Month - April 2005.pdf | 2017-09-25 13:40 | 201 | |
| HOME.HTM | 2017-09-25 13:41 | 2.7K | |
| LSD.HTM | 2017-09-25 13:41 | 4.1K | |
| depression.htm | 2017-09-25 13:41 | 3.3K | |
| introduction.htm | 2017-09-25 13:41 | 3.1K | |
| references.htm | 2017-09-25 13:41 | 5.0K | |
| ser1.gif | 2017-09-25 13:41 | 310 | |
| serotonin.mol | 2017-09-25 13:41 | 285 | |
| serotonin as a neurotransmitter.htm | 2017-09-25 13:41 | 3.6K | |
| synthesis.htm | 2017-09-25 13:41 | 3.3K | |
| home1.htm | 2017-09-25 13:42 | 1.5K | |