![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
![[TXT]](/icons/text.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| SAXITOXIN - Molecule of the Month - Septmber 1998.pdf | 2017-10-04 15:54 | 266K | |
| Thumbs.db | 2005-04-14 09:49 | 8.0K | |
| alexan.jpg | 1998-08-18 16:07 | 55K | |
| blank.gif | 1998-08-18 16:07 | 870 | |
| blue_stc.jpg | 1998-08-18 16:07 | 1.8K | |
| fdalogo.gif | 1998-08-18 16:08 | 2.2K | |
| halgae.gif | 1998-08-18 16:08 | 4.6K | |
| imagemap.gif | 1998-08-18 16:08 | 6.4K | |
| jac1.gif | 1998-08-18 16:08 | 2.3K | |
| kishi.gif | 1998-08-18 16:08 | 2.4K | |
| motmsax.gif | 1998-08-18 16:08 | 36K | |
| noaalogo.gif | 1998-08-18 16:08 | 2.6K | |
| redtide.jpg | 1998-08-18 16:08 | 14K | |
| saxi.htm | 2001-04-25 12:51 | 10K | |
| saxi1.htm | 2017-10-04 15:53 | 10K | |
| spectbar.gif | 1998-08-18 16:08 | 4.0K | |
| stx.gif | 1998-08-18 16:08 | 2.2K | |
| stx.pdb | 1998-08-18 16:08 | 5.0K | |
| title.gif | 1998-08-18 16:08 | 22K | |
| whoilogo.gif | 1998-08-18 16:08 | 1.5K | |
