![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[TXT]](/icons/text.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| DSA.gif | 2017-09-19 12:30 | 3.7K | |
| PT.gif | 2017-09-22 14:04 | 5.3K | |
| Tartrazine- Molecule of the Month - May 2018.pdf | 2018-04-17 11:33 | 473K | |
| Tartrazine.docx | 2017-09-20 14:33 | 15M | |
| article-greg-smith.pdf | 2017-09-18 22:10 | 880K | |
| bigarrow.gif | 2017-09-20 16:54 | 1.9K | |
| cheese.jpg | 2017-09-20 17:28 | 15K | |
| coloured-sweets.jpg | 2017-09-20 12:46 | 55K | |
| doritos.jpg | 2017-09-20 17:31 | 20K | |
| dove.jpg | 2017-09-20 17:36 | 11K | |
| dsa.mol | 2017-09-19 12:42 | 1.9K | |
| galliano.jpg | 2017-09-20 17:32 | 18K | |
| indian-yellow.jpg | 2017-09-20 17:03 | 24K | |
| jellies.jpg | 2017-09-20 16:26 | 21K | |
| life.jpg | 2017-09-20 16:14 | 21K | |
| lipsticks.jpg | 2017-09-20 16:16 | 22K | |
| lysol.jpg | 2017-09-20 17:30 | 15K | |
| m.jpg | 2017-09-20 16:22 | 19K | |
| mandms.jpg | 2017-09-20 16:18 | 41K | |
| mountain-dew.jpg | 2017-09-20 17:31 | 19K | |
| pasta.jpg | 2017-09-20 16:27 | 30K | |
| peas.jpg | 2017-09-20 16:09 | 27K | |
| pt.mol | 2017-09-22 14:24 | 2.4K | |
| pwm-tartrazine.css | 2017-09-20 15:58 | 1.4K | |
| tartrazine-powder.jpg | 2017-09-20 12:58 | 18K | |
| tartrazine.gif | 2017-09-18 22:59 | 11K | |
| tartrazine.mol | 2017-09-18 22:51 | 3.7K | |
| tartrazineh.htm | 2018-04-26 11:33 | 14K | |
| tartrazinejs.htm | 2018-04-26 11:33 | 18K | |
| ziegler.jpg | 2017-09-18 22:25 | 21K | |
