![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
![[TXT]](/icons/text.gif){kind=icon}
![[ ]](/icons/world2.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| TFE.CW2 | 2009-04-17 14:49 | 60K | |
| Teflon - Molecule of the Month June 2009.pdf | 2017-09-21 11:21 | 243K | |
| Thumbs.db | 2009-04-17 15:18 | 160K | |
| gears.gif | 2009-04-17 15:11 | 20K | |
| gears.jpg | 2009-04-01 11:15 | 220K | |
| ink.css | 2009-04-17 13:48 | 107 | |
| pan.gif | 2009-04-17 15:05 | 6.4K | |
| pan.jpg | 2009-04-01 11:15 | 3.0K | |
| plunkett.gif | 2009-04-17 14:46 | 14K | |
| plunkett.jpg | 2009-04-01 11:15 | 42K | |
| ptfe.gif | 2009-04-17 14:43 | 9.8K | |
| ptfe.jpg | 2009-04-01 11:15 | 23K | |
| ptfe.mol | 2009-04-17 15:26 | 4.2K | |
| ptfe.pdb | 2009-04-17 14:05 | 5.0K | |
| ptfe.wrl | 2009-04-30 10:22 | 12K | |
| ptfe1.gif | 2009-04-17 14:44 | 9.8K | |
| ptfe2.gif | 2009-04-17 14:44 | 9.7K | |
| pwm.css | 2009-04-17 13:48 | 972 | |
| tape.gif | 2009-04-17 15:10 | 16K | |
| tape.jpg | 2009-04-01 11:15 | 190K | |
| teflon-st.gif | 2009-04-17 14:58 | 2.3K | |
| teflon.htm | 2009-04-01 09:21 | 28K | |
| teflon1.gif | 2009-04-17 15:08 | 2.1K | |
| teflon1.jpg | 2009-04-01 11:15 | 3.1K | |
| teflonc.htm | 2009-04-30 10:35 | 8.7K | |
| teflonh.htm | 2017-09-21 11:20 | 8.8K | |
| teflonjm.htm | 2009-04-30 10:35 | 9.4K | |
| teflonv.htm | 2009-04-30 10:35 | 8.5K | |
| tfe.gif | 2009-04-17 14:56 | 1.5K | |
| tfe.mol | 2009-04-17 15:25 | 594 | |
| tfe.pdb | 2009-04-17 14:05 | 725 | |
| tfe.wrl | 2009-04-30 10:23 | 2.2K | |
| wires.gif | 2009-04-17 15:12 | 11K | |
| wires.jpg | 2009-04-01 11:15 | 15K | |
