| ![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description | 
|---|---|---|---|---|
| ![[PARENTDIR]](/icons/back.gif) | Parent Directory | - | ||
| ![[   ]](/icons/unknown.gif) | Molecule.class | 1997-04-26 18:38 | 4.2K | |
| ![[   ]](/icons/unknown.gif) | Molecule.java | 1997-04-27 10:59 | 6.5K | |
| ![[TXT]](/icons/text.gif) | Welcome.htm | 1997-04-27 01:17 | 841 | |
| ![[TXT]](/icons/text.gif) | author.htm | 1997-04-26 02:49 | 2.2K | |
| ![[TXT]](/icons/text.gif) | comments.htm | 1997-04-27 02:10 | 2.3K | |
| ![[TXT]](/icons/text.gif) | dedicat.htm | 1997-04-27 00:50 | 2.9K | |
| ![[DIR]](/icons/folder.gif) | images/ | 2001-10-03 12:25 | - | |
| ![[TXT]](/icons/text.gif) | menu.htm | 1997-04-27 00:58 | 3.6K | |
| ![[TXT]](/icons/text.gif) | people.htm | 1997-04-26 18:53 | 2.9K | |
| ![[TXT]](/icons/text.gif) | section1.htm | 1997-04-26 01:48 | 5.7K | |
| ![[TXT]](/icons/text.gif) | section2.htm | 1997-04-26 02:01 | 7.7K | |
| ![[TXT]](/icons/text.gif) | section3.htm | 1997-04-27 10:31 | 11K | |