![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[TXT]](/icons/text.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| Family Life.htm | 2006-06-22 19:59 | 6.4K | |
| Nature1.jpg | 2006-06-22 19:50 | 93K | |
| Nature of the chemical bond.htm | 2006-06-22 20:04 | 10K | |
| Resona1.gif | 2006-06-22 19:50 | 1.9K | |
| Resonance.htm | 2006-06-22 19:49 | 2.5K | |
| activism.htm | 2006-06-22 19:49 | 4.1K | |
| alpha helix.htm | 2006-06-22 19:50 | 435 | |
| benzene.jpg | 2006-06-22 19:50 | 14K | |
| early_family.jpg | 2006-06-22 19:50 | 34K | |
| electronegativity.htm | 2006-06-22 19:50 | 1.1K | |
| hybridization.htm | 2006-06-22 19:50 | 2.5K | |
| index.htm | 2006-06-22 19:58 | 32K | |
| mmbblz.jpg | 2006-06-22 19:50 | 244K | |
| mmbbpn.jpg | 2006-06-22 19:50 | 69K | |
| pau0-019.jpg | 2006-06-22 19:50 | 38K | |
| paulings_rules.htm | 2006-06-22 19:50 | 2.3K | |
| picketing.jpg | 2006-06-22 19:50 | 55K | |
