![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
![[TXT]](/icons/text.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 2PE.gif | 2015-04-15 14:06 | 3.2K | |
| 2PE.mol | 2015-04-15 14:44 | 1.8K | |
| Damascenone - Molecule of the Month - August 2015.pdf | 2017-07-31 10:17 | 387K | |
| MOTM DAMASCENONE.doc | 2015-04-15 13:17 | 426K | |
| adamascenone.gif | 2015-04-15 14:25 | 4.0K | |
| alpha-damascenone.mol | 2015-04-15 15:01 | 2.9K | |
| baked-apples.jpg | 2015-04-15 15:24 | 19K | |
| beta-damascenone.mol | 2015-04-15 14:38 | 2.9K | |
| beta-damascone.mol | 2015-04-15 14:39 | 3.1K | |
| beta-ionone.mol | 2015-04-15 14:46 | 3.1K | |
| bourbon.jpg | 2015-04-15 15:22 | 28K | |
| carotene.gif | 2015-04-15 14:21 | 6.7K | |
| cis-rose-oil.gif | 2015-04-15 14:18 | 4.3K | |
| cis-rose-oil.mol | 2015-04-15 14:55 | 2.7K | |
| citronellol.gif | 2015-04-15 14:00 | 3.9K | |
| citronellol.mol | 2015-04-15 14:41 | 2.8K | |
| damascenone.gif | 2015-04-15 13:55 | 4.0K | |
| damascenoneh.htm | 2017-07-31 10:16 | 14K | |
| damascenonejm.htm | 2015-10-27 10:58 | 18K | |
| damascenonejs.htm | 2017-04-06 16:22 | 28K | |
| damascone.gif | 2015-04-15 14:12 | 3.7K | |
| damask-rose.jpg | 2015-04-15 15:03 | 39K | |
| geraniol.gif | 2015-04-15 14:05 | 4.0K | |
| geraniol.mol | 2015-04-15 14:42 | 2.6K | |
| grapes.jpg | 2015-04-15 15:25 | 25K | |
| ionone.gif | 2015-04-15 14:15 | 3.7K | |
| neoxanthin.gif | 2015-04-15 14:23 | 5.7K | |
| nerol.gif | 2015-04-15 14:08 | 3.9K | |
| nerol.mol | 2015-04-15 14:43 | 2.6K | |
| pwm-damascenone.css | 2016-06-30 00:31 | 1.4K | |
| pwm.css | 2014-06-25 13:07 | 972 | |
| reaction.jpg | 2015-04-15 14:34 | 37K | |
| rose-oil.gif | 2015-04-15 15:47 | 25K | |
| rose-oil.jpg | 2015-04-15 15:13 | 25K | |
| rosewater.jpg | 2015-04-15 15:10 | 32K | |
| tobacco.jpg | 2015-04-15 15:18 | 32K | |
