![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[ ]](/icons/world2.gif){kind=icon}
![[TXT]](/icons/text.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| arrow.gif | 2002-08-22 11:10 | 67 | |
| arsine.doc | 2004-08-16 09:38 | 84K | |
| Arsenic Marsh Test.gif | 2004-08-16 09:38 | 24K | |
| marshtestapp.gif | 2004-08-17 14:22 | 6.4K | |
| orfila.gif | 2004-08-17 14:24 | 25K | |
| ash3a.gif | 2004-08-17 14:28 | 348 | |
| ash3b.gif | 2004-08-17 14:28 | 460 | |
| ARSINE.CW2 | 2004-08-17 14:33 | 14K | |
| arsine.mol | 2004-08-17 14:35 | 431 | |
| arsine.gif | 2004-08-17 14:37 | 4.2K | |
| poison.jpg | 2004-08-17 14:40 | 41K | |
| poison.gif | 2004-08-17 14:42 | 2.7K | |
| napoleon.jpg | 2004-08-17 14:46 | 8.9K | |
| oldlace.jpg | 2004-08-17 14:53 | 6.5K | |
| lafarge.gif | 2004-08-23 10:18 | 11K | |
| feet.jpg | 2004-09-06 09:43 | 6.4K | |
| pc_causeofdeath.gif | 2004-09-20 13:43 | 21K | |
| christie.jpg | 2004-09-20 13:44 | 3.5K | |
| ac_portrait.gif | 2004-09-20 13:45 | 5.7K | |
| dorothy.jpg | 2004-09-20 13:45 | 13K | |
| cornwell.jpg | 2004-09-20 13:48 | 6.9K | |
| dorothysayers.jpg | 2004-09-20 13:59 | 5.2K | |
| arsine.wrl | 2004-09-29 17:17 | 9.0K | |
| arsinec.htm | 2005-01-21 09:57 | 18K | |
| arsinejm.htm | 2005-01-21 09:57 | 18K | |
| arsinev.htm | 2005-01-21 09:57 | 18K | |
| prostanoicjm.htm | 2006-09-13 12:22 | 13K | |
| Thumbs.db | 2007-02-02 17:01 | 74K | |
| pwm-arsine.css | 2017-07-13 12:50 | 1.4K | |
| roxarsone.gif | 2017-07-13 15:00 | 2.3K | |
| arsinejs.htm | 2017-07-13 15:08 | 17K | |
| arsineh.htm | 2017-07-26 16:56 | 16K | |
| Arsine - Molecule of the Month - January 2005.pdf | 2017-07-26 16:57 | 185K | |