![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
![[TXT]](/icons/text.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| ARTEMISININ.docx | 2013-01-17 09:27 | 3.1M | |
| Amorphadiene.mol | 2016-10-10 13:45 | 3.6K | |
| Artemisinin - Molecule of the Month May 2013.pdf | 2017-07-29 15:21 | 396K | |
| aacid.cw2 | 2013-01-21 17:04 | 71K | |
| amorph.cw2 | 2013-01-21 17:04 | 57K | |
| amorph.mol | 2016-10-10 13:54 | 3.6K | |
| amorphadiene.gif | 2013-01-22 14:19 | 2.9K | |
| arrow.gif | 2002-08-22 11:10 | 67 | |
| artem.cw2 | 2013-01-21 17:00 | 78K | |
| artemether.gif | 2013-01-22 14:05 | 3.5K | |
| artemether.mol | 2013-01-21 17:26 | 4.0K | |
| artemisin-sf.gif | 2013-01-25 11:31 | 8.8K | |
| artemisini-bottles-colour-small.gif | 2013-01-22 14:17 | 34K | |
| artemisini-bottles-colour-small.jpg | 2013-01-22 14:15 | 24K | |
| artemisini-bottles-colour.jpg | 2013-01-16 10:30 | 65K | |
| artemisinic-acid.gif | 2013-01-22 14:20 | 3.2K | |
| artemisinic-acid.mol | 2013-01-21 17:26 | 3.3K | |
| artemisinin-sf.gif | 2013-01-25 11:32 | 8.8K | |
| artemisinin.gif | 2013-01-22 13:50 | 4.8K | |
| artemisinin.mol | 2013-01-21 17:26 | 3.6K | |
| artemisininh.htm | 2017-07-29 15:21 | 15K | |
| artemisininjm.htm | 2013-04-30 12:48 | 19K | |
| artemisininjs.htm | 2017-04-06 16:34 | 29K | |
| artemisone.gif | 2013-01-22 14:25 | 4.1K | |
| artemisone.mol | 2013-01-21 17:25 | 5.0K | |
| artemsn.cw2 | 2013-01-21 17:07 | 130K | |
| artemt.cw2 | 2013-01-21 17:02 | 79K | |
| artes.cw2 | 2013-01-21 17:01 | 146K | |
| artesunate.gif | 2013-01-22 14:01 | 3.9K | |
| artesunate.mol | 2013-01-21 17:25 | 4.6K | |
| dhaa.cw2 | 2013-01-21 17:05 | 71K | |
| dhaa.gif | 2013-01-22 14:22 | 3.3K | |
| dhaa.mol | 2016-10-10 13:55 | 3.7K | |
| dihyd.cw2 | 2013-01-21 17:02 | 75K | |
| dihydroartemisinic-acid.mol | 2013-01-21 17:24 | 3.5K | |
| dihydroartemisinin.gif | 2013-01-22 14:07 | 3.7K | |
| dihydroartimisinin.mol | 2013-01-21 17:24 | 3.7K | |
| mosquito-researcher.gif | 2013-01-22 14:42 | 54K | |
| mosquito.gif | 2013-01-22 14:58 | 4.4K | |
| oz277.cw2 | 2013-01-21 17:11 | 129K | |
| oz277.gif | 2013-01-22 14:35 | 2.5K | |
| oz277.mol | 2013-01-21 17:24 | 5.4K | |
| oz439.cw2 | 2013-01-21 17:13 | 149K | |
| oz439.gif | 2013-01-22 14:37 | 2.9K | |
| oz439.mol | 2013-01-21 17:23 | 6.1K | |
| pwm-art.css | 2016-10-07 13:56 | 1.4K | |
| pwm.css | 2013-01-09 11:49 | 972 | |
| rka182.cw2 | 2013-01-21 17:16 | 154K | |
| rka182.gif | 2013-01-22 14:39 | 3.6K | |
| rka182.mol | 2013-01-21 17:23 | 6.7K | |
| sweet-wormwood.jpg | 2013-01-22 13:54 | 37K | |
| youyou-tu.jpg | 2013-01-22 13:57 | 10K | |
