![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[TXT]](/icons/text.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| pwm-chlorhexidine.css | 2017-01-07 16:48 | 1.4K | |
| Chlorhexidine article.docx | 2020-06-06 13:16 | 1.6M | |
| spacefill.jpg | 2020-06-06 14:06 | 19K | |
| chlorhexidine.gif | 2020-06-06 14:12 | 12K | |
| mouthwash.jpg | 2020-06-06 14:30 | 21K | |
| corsodyl.jpg | 2020-06-06 14:39 | 36K | |
| mechanism.jpg | 2020-06-06 14:41 | 92K | |
| teeth.gif | 2020-06-06 14:47 | 6.8K | |
| gel.jpg | 2020-06-06 14:59 | 30K | |
| cord.jpg | 2020-06-06 15:07 | 55K | |
| products.jpg | 2020-06-06 15:24 | 43K | |
| proguanil.gif | 2020-06-06 15:29 | 5.6K | |
| hexamethylenediamine.gif | 2020-06-06 15:30 | 3.3K | |
| 640px-Chlorhexidine_synthesis.png | 2020-06-06 15:39 | 45K | |
| synthesis.gif | 2020-06-06 15:49 | 21K | |
| dental-mouthwash.jpg | 2020-06-06 15:50 | 19K | |
| chlorhexidine.mol | 2020-06-06 15:56 | 5.8K | |
| proguanil.mol | 2020-06-06 15:57 | 3.0K | |
| hexamethylenediamine.mol | 2020-06-06 15:58 | 2.2K | |
| chlorhexidineh.htm | 2020-07-25 13:03 | 15K | |
| chlorhexidinejs.htm | 2020-07-25 13:03 | 19K | |
| Chlorhexidine - Molecule of the Month - August 2020.pdf | 2020-07-25 13:06 | 489K | |