![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[ ]](/icons/world2.gif){kind=icon}
![[TXT]](/icons/text.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| adrenaline.gif | 2008-09-17 13:25 | 2.5K | |
| apomorphine.gif | 2008-09-17 13:25 | 2.9K | |
| Biosynthesis.gif | 2008-09-17 13:25 | 4.8K | |
| Dopamine.gif | 2008-09-17 13:25 | 17K | |
| Dopamine 2.gif | 2008-09-17 13:25 | 17K | |
| dopamine skel.gif | 2008-09-17 13:25 | 2.1K | |
| Essay.gif | 2008-09-17 13:25 | 9.5K | |
| noradrenaline.gif | 2008-09-17 13:25 | 2.5K | |
| prolactin.gif | 2008-09-17 13:25 | 6.4K | |
| Dopamine.jpg | 2008-09-17 13:25 | 13K | |
| Parkinson.jpg | 2008-09-17 13:25 | 6.4K | |
| adrenaline.mol | 2008-09-17 13:25 | 2.4K | |
| apomorphine.mol | 2008-09-17 13:25 | 3.4K | |
| dopamine.mol | 2008-09-17 13:25 | 2.0K | |
| adrenaline.cdx | 2008-09-17 13:25 | 1.9K | |
| apomorphine.cdx | 2008-09-17 13:25 | 2.3K | |
| noradrenaline.mol | 2008-09-17 13:25 | 2.1K | |
| Biosynthesis.cdx | 2008-09-17 13:25 | 5.0K | |
| dopamine.cdx | 2008-09-17 13:25 | 1.6K | |
| noradrenaline.cdx | 2008-09-17 13:25 | 1.8K | |
| adrenaline.wrl | 2008-09-18 17:07 | 7.4K | |
| apomorphine.wrl | 2008-09-18 17:07 | 11K | |
| dopamine.wrl | 2008-09-18 17:07 | 6.6K | |
| noradrenaline.wrl | 2008-09-18 17:07 | 6.7K | |
| dopaminev.htm | 2008-09-18 17:15 | 12K | |
| dopaminejm.htm | 2008-09-18 17:30 | 13K | |
| dopaminec.htm | 2008-09-18 17:30 | 12K | |
| dopamineh.htm | 2017-09-21 11:31 | 12K | |
| Dopamine - Molecule of the Month October 2008.pdf | 2017-09-21 11:31 | 227K | |