![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
![[ ]](/icons/world2.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
![[TXT]](/icons/text.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| Ethene - Molecule of the month - December 2006.pdf | 2017-07-27 10:16 | 270K | |
| polystyrene.wrl | 2006-07-25 17:11 | 154K | |
| motm ethene.doc | 2006-07-24 09:34 | 120K | |
| pvc.wrl | 2006-07-25 17:12 | 101K | |
| polythene.wrl | 2006-07-25 17:12 | 85K | |
| ETHENE.CW2 | 2006-07-24 15:11 | 78K | |
| ZEISSE.CW2 | 2006-07-25 17:04 | 51K | |
| spoofsun.gif | 2006-07-26 11:54 | 42K | |
| abbeyroad.gif | 2006-07-24 15:02 | 39K | |
| the Oracle.gif | 2006-07-24 14:44 | 37K | |
| styrene.wrl | 2006-07-25 17:12 | 32K | |
| STYRENE.CW2 | 2006-07-25 16:24 | 29K | |
| sun.jpg | 2006-07-24 10:30 | 25K | |
| ethenejs.htm | 2017-07-08 12:47 | 25K | |
| DIOL.CW2 | 2006-07-25 16:23 | 24K | |
| ethenejm.htm | 2006-08-01 08:44 | 21K | |
| zeisse.wrl | 2006-07-25 17:12 | 21K | |
| diol.wrl | 2006-07-25 17:10 | 20K | |
| ethenec.htm | 2006-08-01 08:37 | 20K | |
| ethenev.htm | 2006-09-25 11:22 | 20K | |
| ethanol.wrl | 2006-07-25 17:11 | 18K | |
| etheneh.htm | 2017-07-27 10:14 | 17K | |
| bananas.gif | 2006-07-24 14:58 | 15K | |
| ethene.wrl | 2006-07-25 17:11 | 13K | |
| ETHANOL.CW2 | 2006-07-25 16:22 | 11K | |
| ethenebs.gif | 2006-07-24 15:17 | 6.5K | |
| polystyrene.mol | 2006-07-25 16:31 | 6.2K | |
| ethenesf.gif | 2006-07-24 15:17 | 5.6K | |
| polypropylene.mol | 2006-07-25 16:31 | 4.9K | |
| pvc.mol | 2006-07-25 16:31 | 4.3K | |
| polythene.gif | 2006-07-24 14:49 | 3.7K | |
| polythene.mol | 2006-07-25 16:30 | 3.6K | |
| eths.gif | 2006-07-24 14:46 | 2.6K | |
| diol.gif | 2017-07-07 23:55 | 2.4K | |
| styrene.gif | 2017-07-07 23:54 | 2.4K | |
| ethanol.gif | 2017-07-07 23:55 | 2.3K | |
| styrene.mol | 2006-07-25 16:26 | 1.4K | |
| pwm-ethene.css | 2017-07-07 22:46 | 1.4K | |
| ptcl3h4.gif | 2006-07-24 14:55 | 1.3K | |
| ldpe.gif | 2006-07-26 11:19 | 1.3K | |
| hdpe.gif | 2006-07-26 11:20 | 1.3K | |
| ethene.gif | 2006-07-24 15:15 | 1.0K | |
| zeisse.mol | 2006-07-25 17:06 | 961 | |
| diol.mol | 2006-07-25 16:26 | 941 | |
| ethanol.mol | 2006-07-25 16:25 | 856 | |
| ethene.mol | 2006-07-24 15:12 | 601 | |
| arrow.gif | 2002-08-22 11:10 | 67 | |
