![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[TXT]](/icons/text.gif){kind=icon}
![[ ]](/icons/world2.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| Heptan-2-one - Molecule of the Month October 2010.pdf | 2017-07-28 11:33 | 449K | |
| Atta_Texana.jpg | 2010-07-16 15:00 | 234K | |
| shropshire.jpg | 2010-07-16 14:44 | 167K | |
| motm heptan-2-ONE.doc | 2010-07-08 09:47 | 84K | |
| Blue_Stilton.jpg | 2010-07-16 14:34 | 77K | |
| NONANON.CW2 | 2010-07-16 14:16 | 61K | |
| Atta_Texana.gif | 2010-07-16 15:00 | 51K | |
| HEPTANON.CW2 | 2010-07-16 14:14 | 47K | |
| Blue_Stilton.gif | 2010-07-16 14:35 | 36K | |
| caddis.gif | 2010-07-16 15:02 | 34K | |
| PENTANON.CW2 | 2010-07-16 14:16 | 33K | |
| Iodoformprobe.gif | 2010-07-16 15:06 | 31K | |
| roquefortcheese.jpg | 2010-07-16 14:41 | 29K | |
| motm heptan-2-ONE PICTURES.doc | 2010-07-08 09:47 | 29K | |
| Bleu_auvergne.jpg | 2010-07-16 14:46 | 26K | |
| cashelblue.gif | 2010-07-16 14:44 | 24K | |
| shropshire.gif | 2010-07-16 14:45 | 23K | |
| heptanonejs.htm | 2017-04-06 16:50 | 21K | |
| Bleu_auvergne.gif | 2010-07-16 14:47 | 21K | |
| heptanonejm.htm | 2010-08-05 08:58 | 19K | |
| gorgonzola.gif | 2010-07-16 14:42 | 19K | |
| heptanonec.htm | 2010-08-05 08:52 | 18K | |
| heptanonev.htm | 2010-08-05 08:54 | 18K | |
| heptanoneh.htm | 2017-07-28 11:30 | 17K | |
| caddis.jpg | 2010-07-16 15:02 | 16K | |
| roquefortcheese.gif | 2010-07-16 14:41 | 15K | |
| -Gorgonzola.jpg | 2010-07-16 14:42 | 14K | |
| cabrales.gif | 2010-07-16 14:57 | 14K | |
| Iodoformprobe.jpg | 2010-07-16 15:05 | 12K | |
| CashelBlue.JPG | 2010-07-16 14:43 | 12K | |
| cheese_cabrales.jpg | 2010-07-16 14:56 | 9.3K | |
| nmr.gif | 2010-07-16 14:11 | 7.7K | |
| nonanone.wrl | 2010-07-16 14:21 | 6.8K | |
| heptanone-sf.gif | 2010-07-16 14:23 | 6.7K | |
| reaction.gif | 2010-07-16 13:53 | 5.9K | |
| cheese-smelly.gif | 2010-07-16 15:21 | 5.6K | |
| heptanone.wrl | 2010-07-16 14:20 | 5.5K | |
| pentanone.wrl | 2010-07-16 14:21 | 4.3K | |
| Smelly_cheese.gif | 2010-07-16 15:15 | 3.8K | |
| Cheese---Smelly.gif | 2010-07-16 15:19 | 3.2K | |
| nonanone.mol | 2010-07-16 14:21 | 2.4K | |
| smelly-cheese.gif | 2010-07-16 15:16 | 2.2K | |
| heptanone.mol | 2010-07-16 14:20 | 1.9K | |
| iodoform-test.gif | 2010-07-16 14:01 | 1.7K | |
| pwm-heptanone.css | 2017-03-24 14:58 | 1.6K | |
| pentanone.mol | 2010-07-16 14:21 | 1.4K | |
| labelled-molecule.gif | 2010-07-16 14:06 | 1.1K | |
| pwm.css | 2008-04-22 14:23 | 972 | |
| reaction1.gif | 2010-07-16 13:55 | 954 | |
| arrow.jpg | 2000-11-25 16:03 | 768 | |
| nonanone.gif | 2010-07-16 14:29 | 507 | |
| heptanone.gif | 2010-07-16 14:29 | 432 | |
| pentanone.gif | 2010-07-16 14:29 | 363 | |
| PENTANON.CHM | 2010-07-16 14:17 | 280 | |
| arrow.gif | 2010-07-16 13:59 | 108 | |
| ink.css | 2008-04-22 14:23 | 107 | |