![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
![[TXT]](/icons/text.gif){kind=icon}
![[ ]](/icons/world2.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| INDIGO.CW2 | 2009-01-26 11:29 | 87K | |
| Indian_indigo_dye_lump.jpg | 2009-01-26 09:49 | 122K | |
| Indigo_plant_extract_sample.jpg | 2009-01-26 09:49 | 21K | |
| Indigotin - Molecule of the Month - February 2009.pdf | 2017-07-27 15:26 | 216K | |
| Thumbs.db | 2010-06-03 13:25 | 49K | |
| baeyer.gif | 2009-01-26 11:55 | 6.9K | |
| baeyer.jpg | 2009-01-26 11:53 | 12K | |
| clrline-blue.gif | 2009-01-26 12:10 | 1.2K | |
| indigo-lump.jpg | 2009-01-26 12:54 | 18K | |
| indigo-powder.jpg | 2009-01-26 12:54 | 17K | |
| indigo.css | 2009-01-26 12:51 | 1.1K | |
| indigotin-sf.jpg | 2009-01-26 12:54 | 13K | |
| indigotin.gif | 2009-01-26 11:30 | 1.4K | |
| indigotin.mol | 2009-01-26 11:33 | 2.7K | |
| indigotin.wrl | 2009-01-26 12:55 | 10K | |
| indigotinc.htm | 2009-01-26 12:59 | 10K | |
| indigotinh.htm | 2017-07-27 15:25 | 10K | |
| indigotinjm.htm | 2009-01-26 13:01 | 11K | |
| indigotinjs.htm | 2017-07-23 14:20 | 12K | |
| indigotinv.htm | 2009-01-26 12:57 | 10K | |
| ink.css | 2008-11-04 13:21 | 107 | |
| jean-shorts.jpg | 2009-01-26 09:51 | 51K | |
| jean-shorts1.jpg | 2009-01-26 12:54 | 19K | |
| mechanism1.gif | 2009-01-26 11:50 | 2.6K | |
| pwm-indigotin.css | 2017-07-04 12:49 | 1.5K | |
| pwm.css | 2009-01-26 12:15 | 1.1K | |
| toureg.jpg | 2009-01-26 11:46 | 25K | |
| vos.jpg | 2009-01-26 12:18 | 16K | |
| yarn-dyed-with-indigo.jpg | 2009-01-26 11:42 | 27K | |
