![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
![[TXT]](/icons/text.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| MMDA.gif | 2014-06-24 14:13 | 4.5K | |
| MMDA.mol | 2014-06-26 11:17 | 2.8K | |
| Mryristicin - - Molecule of the Month - August 2014.pdf | 2017-07-30 16:05 | 299K | |
| elemicin.gif | 2014-06-24 14:17 | 4.3K | |
| elemicin.mol | 2014-06-26 11:16 | 2.8K | |
| myristica.jpg | 2014-06-24 12:54 | 68K | |
| myristicin.gif | 2014-06-24 14:11 | 4.3K | |
| myristicin.mol | 2014-06-26 11:15 | 2.4K | |
| myristicinh.docx | 2014-06-24 17:17 | 1.6M | |
| myristicinh.htm | 2017-07-30 16:04 | 11K | |
| myristicinjm.htm | 2015-04-28 09:17 | 12K | |
| myristicinjs.htm | 2017-07-23 12:49 | 15K | |
| nutmeg-and-mace.jpg | 2014-06-24 16:55 | 27K | |
| nutmeg-bottle.gif | 2014-06-24 17:13 | 13K | |
| nutmegs-on-tree.jpg | 2014-06-24 12:59 | 27K | |
| nutmegs.jpg | 2014-06-24 16:59 | 41K | |
| pwm-myristicin.css | 2016-06-13 10:42 | 1.4K | |
| pwm.css | 2014-06-25 13:07 | 972 | |
| run-island.jpg | 2014-06-24 12:49 | 73K | |
