![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
![[TXT]](/icons/text.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| arrow.gif | 2002-08-22 11:10 | 67 | |
| ink.css | 2009-12-18 10:22 | 107 | |
| ocnh-bond.gif | 2009-12-18 11:54 | 442 | |
| pwm.css | 2009-12-18 10:22 | 972 | |
| pwm-nylon.css | 2017-06-29 10:39 | 1.4K | |
| clrline-green.gif | 2016-06-13 11:27 | 2.2K | |
| adipoylreaction.gif | 2010-01-22 12:31 | 4.8K | |
| nylon.mol | 2010-01-22 12:42 | 7.1K | |
| polymer.gif | 2010-01-22 11:58 | 7.1K | |
| condensation.gif | 2010-01-22 11:56 | 8.2K | |
| nylonsf.jpg | 2010-01-22 12:44 | 9.6K | |
| caprolactam.gif | 2010-01-22 12:01 | 13K | |
| Nylon riots.jpg | 2009-10-19 09:39 | 14K | |
| parachutes.gif | 2010-01-22 12:14 | 16K | |
| carothers.gif | 2010-01-22 11:50 | 17K | |
| nylonh.htm | 2017-07-28 11:14 | 18K | |
| nylonv.htm | 2010-02-01 14:06 | 19K | |
| nylonc.htm | 2010-02-01 14:17 | 19K | |
| nylonjm.htm | 2010-02-01 14:20 | 19K | |
| nylonjs.htm | 2017-06-29 11:18 | 20K | |
| nylonqueues.jpg | 2010-01-22 12:17 | 20K | |
| Nylon stocking kerb.jpg | 2009-10-19 09:39 | 21K | |
| kerb.jpg | 2010-01-22 12:32 | 22K | |
| parachutes.jpg | 2010-01-22 12:12 | 24K | |
| Nylon Man in white Suit 2.jpg | 2009-10-19 09:39 | 29K | |
| Nylon DuPont 2.jpg | 2009-10-19 09:39 | 30K | |
| Thumbs.db | 2009-12-18 10:20 | 32K | |
| schlack.jpg | 2010-01-22 12:02 | 35K | |
| Nylon Paul Schlack.jpg | 2009-10-19 09:39 | 36K | |
| mws.gif | 2010-01-22 12:24 | 38K | |
| schlack.gif | 2010-01-22 12:02 | 39K | |
| nylonad1.jpg | 2010-01-22 12:09 | 42K | |
| staudinger.gif | 2010-01-22 11:47 | 49K | |
| mws2.gif | 2010-01-22 12:25 | 52K | |
| street.gif | 2010-01-22 12:21 | 52K | |
| Nylon dupont 5.jpg | 2009-10-19 09:39 | 55K | |
| nylonad2.jpg | 2010-01-22 12:09 | 56K | |
| Nylon Carothers.jpg | 2009-10-19 09:39 | 57K | |
| carothers.jpg | 2010-01-22 11:50 | 61K | |
| staudinger.jpg | 2010-01-22 11:48 | 63K | |
| Nylon toothbrush.jpg | 2009-10-19 09:39 | 68K | |
| Nylon DuPont 1.jpg | 2009-10-19 09:39 | 71K | |
| Nylon Staudinger 1.jpg | 2009-10-19 09:39 | 71K | |
| mws.jpg | 2010-01-22 12:24 | 95K | |
| nylon-toothbrush.jpg | 2010-01-22 12:06 | 98K | |
| Nylon Man in White suit.jpg | 2009-10-19 09:39 | 108K | |
| Nylon dupont 3.jpg | 2009-10-19 09:39 | 191K | |
| NYLON.CW2 | 2010-01-22 12:38 | 217K | |
| motm NYLON 2.doc | 2009-10-19 09:38 | 522K | |
| Nylon - Molecule of the Month June 2010.pdf | 2017-07-28 11:15 | 740K | |