![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
![[TXT]](/icons/text.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| wallace.jpg | 2018-04-11 11:49 | 30K | |
| tower.gif | 2018-04-11 11:53 | 6.9K | |
| spitfire.jpg | 2018-04-11 12:30 | 21K | |
| seaplane.jpg | 2018-04-11 12:30 | 31K | |
| pwm-octane.css | 2018-04-11 10:10 | 1.4K | |
| pumps.jpg | 2018-04-11 12:15 | 30K | |
| octanejs.htm | 2019-11-12 15:21 | 21K | |
| octaneh.htm | 2019-11-12 15:21 | 16K | |
| octane.mol | 2018-04-11 11:19 | 2.4K | |
| octane.gif | 2018-04-11 11:09 | 2.7K | |
| octane-sf.gif | 2018-04-11 10:13 | 35K | |
| marker.jpg | 2018-04-11 11:24 | 46K | |
| liquid.jpg | 2018-04-11 13:20 | 25K | |
| gusher.jpg | 2018-04-11 12:01 | 15K | |
| cracker.jpg | 2018-04-11 11:30 | 48K | |
| caterpillar.jpg | 2018-04-11 12:07 | 22K | |
| bottle.jpg | 2019-01-22 23:23 | 20K | |
| arrow.gif | 2016-05-20 17:46 | 1.6K | |
| Octane - Molecule of the Month - February 2019.pdf | 2019-01-23 13:35 | 429K | |
| MOTM OCTANE.doc | 2018-04-11 13:26 | 3.3M | |
| 224trimethylpentane.mol | 2018-04-11 11:21 | 2.4K | |
| 224trimethylpentane.gif | 2018-04-11 11:10 | 2.6K | |
| 2methylheptane.mol | 2018-04-11 11:20 | 2.4K | |
| 2methylheptane.gif | 2018-04-11 11:09 | 2.8K | |
