![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[TXT]](/icons/text.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
![[ ]](/icons/world2.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| synthesis.htm | 2017-02-02 13:48 | 11K | |
| synthe1.gif | 2004-06-16 12:09 | 15K | |
| serotoninh.htm | 2017-09-25 13:39 | 11K | |
| serotonin as a neurotransmitter.htm | 2017-02-02 13:48 | 12K | |
| serotonin.wrl | 2005-01-14 14:32 | 49K | |
| serotonin.mol | 2004-06-16 12:11 | 2.1K | |
| seroto2.gif | 2004-06-16 12:09 | 31K | |
| ser1.gif | 2005-01-14 14:22 | 5.4K | |
| references.htm | 2017-02-02 13:48 | 17K | |
| lsd.ht3.jpg | 2004-06-14 14:49 | 3.3K | |
| introduction.htm | 2017-02-02 13:48 | 14K | |
| home1.htm | 2017-09-25 13:42 | 6.1K | |
| home.htm | 2017-02-02 13:48 | 12K | |
| depression.htm | 2017-02-02 13:48 | 13K | |
| depres2.gif | 2004-06-16 13:22 | 2.3K | |
| _themes/ | 2005-01-14 10:20 | - | |
| _derived/ | 2005-01-14 10:20 | - | |
| _borders/ | 2005-01-14 10:20 | - | |
| _VTI_PVT/ | 2005-01-14 10:20 | - | |
| _VTI_CNF/ | 2017-09-25 14:29 | - | |
| _OVERLAY/ | 2017-02-02 17:02 | - | |
| Thumbs.db | 2005-04-14 09:49 | 7.5K | |
| Test_frames/ | 2005-01-14 10:20 | - | |
| Serotonin Molecule of the Month - April 2005.pdf | 2017-09-25 13:40 | 289K | |
| Page_11.gif | 2004-06-16 12:18 | 680 | |
| LSD_files/ | 2005-01-14 10:20 | - | |
| LSD.HTM | 2017-02-02 13:48 | 15K | |
| DESKTOP.INI | 2000-02-25 12:03 | 114 | |