![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
![[TXT]](/icons/text.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| Silica - Molecule of the Month November 2013.pdf | 2017-09-18 12:06 | 477K | |
| silicah.htm | 2017-09-18 12:05 | 12K | |
| mountains.jpg | 2013-10-07 10:27 | 38K | |
| quartz1.jpg | 2013-10-07 10:18 | 33K | |
| sandcastle.jpg | 2013-10-07 10:13 | 92K | |
| si-chip.jpg | 2013-10-07 10:11 | 55K | |
| glassware.jpg | 2013-10-07 10:09 | 45K | |
| windows.jpg | 2013-10-07 10:06 | 28K | |
| glass-structure.gif | 2013-10-07 10:04 | 16K | |
| tet.gif | 2013-10-07 10:01 | 3.3K | |
| quartz.jpg | 2013-10-07 09:58 | 28K | |
| structure.gif | 2013-10-07 09:56 | 9.0K | |
| sio4.gif | 2013-10-07 09:52 | 6.5K | |
| Silica.docx | 2013-10-07 09:03 | 1.6M | |
| pwm.css | 2010-10-19 11:43 | 972 | |