![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[TXT]](/icons/text.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| pixelskin.gif | 2000-06-20 15:02 | 809 | |
| wordart.jpg | 2000-06-20 15:02 | 8.1K | |
| weblabthalidomide.jpg | 2000-06-20 15:02 | 9.9K | |
| home.gif | 2000-06-20 15:03 | 1.5K | |
| first_pic.jpg | 2000-06-20 15:03 | 20K | |
| thalid2.jpg | 2000-06-20 15:03 | 24K | |
| kelsey.jpg | 2000-06-20 15:03 | 3.6K | |
| bckgrd.gif | 2000-06-20 15:04 | 12K | |
| home2.gif | 2000-06-20 15:04 | 1.5K | |
| isomerism.gif | 2000-06-20 15:04 | 13K | |
| structural.gif | 2000-06-20 15:04 | 5.5K | |
| geometric.gif | 2000-06-20 15:04 | 6.4K | |
| optical.gif | 2000-06-20 15:04 | 5.1K | |
| optical2.gif | 2000-06-20 15:04 | 10K | |
| back.jpg | 2000-06-20 15:04 | 7.5K | |
| butane.jpg | 2000-06-20 15:05 | 14K | |
| methylpropane.jpg | 2000-06-20 15:05 | 14K | |
| ethanol.gif | 2000-06-20 15:05 | 1.4K | |
| methoxymethane.gif | 2000-06-20 15:05 | 1.4K | |
| cis.gif | 2000-06-20 15:06 | 5.1K | |
| trans.gif | 2000-06-20 15:06 | 5.2K | |
| which.gif | 2000-06-20 15:06 | 4.0K | |
| priority.gif | 2000-06-20 15:06 | 4.5K | |
| cyclic.gif | 2000-06-20 15:06 | 4.0K | |
| opticalisomer.gif | 2000-06-20 15:06 | 4.7K | |
| example.gif | 2000-06-20 15:06 | 6.6K | |
| example2.gif | 2000-06-20 15:06 | 7.6K | |
| priority2.gif | 2000-06-20 15:07 | 4.3K | |
| view.gif | 2000-06-20 15:07 | 3.4K | |
| weblabthalidomide.gif | 2000-06-20 15:08 | 7.9K | |
| chiral2.gif | 2000-06-20 15:08 | 4.8K | |
| chiral.gif | 2000-06-20 15:08 | 5.1K | |
| lep.jpg | 2000-06-20 15:10 | 8.1K | |
| thalidomide.jpg | 2000-06-20 15:10 | 22K | |
| home3.gif | 2000-06-20 16:09 | 1.5K | |
| thalidomide.mol | 2000-06-27 12:00 | 2.2K | |
| butane.mol | 2000-06-27 12:02 | 1.1K | |
| 2_methylpropane.mol | 2000-06-27 12:03 | 1.1K | |
| cis_dce.mol | 2000-06-27 12:05 | 546 | |
| trans_dce.mol | 2000-06-27 12:05 | 548 | |
| cyclo.mol | 2000-06-27 12:09 | 1.1K | |
| optiso1.mol | 2000-06-27 12:11 | 771 | |
| optiso2.mol | 2000-06-27 12:12 | 771 | |
| thalidomide_s.mol | 2000-06-27 12:18 | 2.6K | |
| example3.gif | 2000-06-27 13:50 | 4.3K | |
| example4.gif | 2000-06-27 13:50 | 4.4K | |
| return.html | 2000-06-30 09:58 | 3.6K | |
| effects.html | 2000-06-30 10:02 | 3.7K | |
| opticaliso.html | 2000-06-30 10:06 | 3.7K | |
| isomerfront.html | 2000-06-30 10:08 | 1.1K | |
| geometriciso.html | 2000-06-30 10:11 | 4.0K | |
| first.html | 2000-06-30 10:13 | 2.3K | |
| structuraliso.html | 2000-06-30 10:13 | 2.4K | |
| optical2iso.html | 2004-10-18 11:30 | 2.2K | |
| Thumbs.db | 2005-04-14 09:49 | 8.0K | |
| TBP.CW2 | 2011-10-10 16:09 | 55K | |
| start.html | 2017-08-04 11:33 | 2.6K | |
| thal.htm | 2017-08-04 11:33 | 11K | |
| Thalidomide - Molecule of the Month - July 2000.pdf | 2017-08-04 11:34 | 240K | |