![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[TXT]](/icons/text.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| pwm.css | 2012-07-30 13:14 | 972 | |
| pwm-tramadol.css | 2016-07-26 11:37 | 1.4K | |
| 1R2R-odsmt.mol | 2014-07-03 13:33 | 3.7K | |
| 1S2S-odsmt.mol | 2014-07-03 13:33 | 3.7K | |
| 1R2R-tramadol.mol | 2014-07-03 13:16 | 4.0K | |
| 1S2S-tramadol.mol | 2014-07-03 13:21 | 4.0K | |
| 1R2R-odsmt.gif | 2014-07-03 13:29 | 4.2K | |
| tramadol.gif | 2014-07-03 11:24 | 4.2K | |
| odes.gif | 2014-07-03 11:06 | 4.2K | |
| 1S2S-odsmt.gif | 2014-07-03 13:29 | 4.2K | |
| 1R2R-tramadol.gif | 2014-07-03 11:12 | 4.3K | |
| 1S2S-tramadol.gif | 2014-07-03 11:12 | 4.4K | |
| synthesis.gif | 2014-07-03 11:02 | 11K | |
| tramadolh.htm | 2017-07-30 16:12 | 16K | |
| tramadoljm.htm | 2016-01-08 16:02 | 18K | |
| tramadol-pills.jpg | 2014-07-03 12:03 | 20K | |
| tramadoljs.htm | 2017-04-06 16:28 | 21K | |
| barry.jpg | 2014-07-03 11:53 | 27K | |
| headline.jpg | 2014-07-03 10:07 | 46K | |
| pin-cushion-tree.jpg | 2014-07-03 11:37 | 56K | |
| froome.jpg | 2014-07-03 11:44 | 75K | |
| Tramadol - Molecule of the Month September 2014.pdf | 2017-07-30 16:12 | 383K | |
| MOTM TRAMADOL.doc | 2014-07-03 09:57 | 601K | |