![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
![[TXT]](/icons/text.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| arrow.gif | 2016-05-20 17:46 | 1.6K | |
| pwm-thallium.css | 2017-01-07 16:48 | 1.4K | |
| structure.gif | 2018-01-23 15:12 | 7.1K | |
| powder.jpg | 2018-01-23 15:14 | 31K | |
| sugar.jpg | 2018-01-23 15:23 | 17K | |
| ringworm-rash.jpg | 2018-01-23 15:25 | 22K | |
| owl.jpg | 2018-01-25 15:24 | 78K | |
| moumie.jpg | 2018-01-29 14:20 | 32K | |
| pale-horse.jpg | 2018-01-29 14:44 | 42K | |
| final-curtain.jpg | 2018-01-29 14:45 | 32K | |
| young.jpg | 2018-01-29 14:46 | 29K | |
| broadmoor.jpg | 2018-01-29 14:48 | 61K | |
| ringworm.jpg | 2018-01-29 14:52 | 27K | |
| lemmy.jpg | 2018-01-29 15:00 | 39K | |
| spectrum.jpg | 2018-01-29 15:01 | 16K | |
| aunt-thally.jpg | 2018-01-29 15:13 | 68K | |
| MOTM-Thallium-sulfate-MAT-2018-1.docx | 2018-01-29 15:15 | 3.7M | |
| vincent.jpg | 2018-01-30 14:09 | 59K | |
| prussian-blue.jpg | 2018-01-30 17:10 | 41K | |
| house.jpg | 2018-01-30 17:32 | 19K | |
| csiny.jpg | 2018-01-30 17:32 | 29K | |
| spectre.jpg | 2018-01-30 17:32 | 24K | |
| edge.jpg | 2018-01-30 17:32 | 34K | |
| cine.jpg | 2018-01-30 17:39 | 39K | |
| tl-flame.jpg | 2018-01-30 17:45 | 11K | |
| pb-structure.gif | 2018-01-30 17:48 | 18K | |
| young1.jpg | 2018-01-30 17:48 | 26K | |
| Thallium Sulfate - Molecule of the Month - July 2018.pdf | 2018-06-08 14:43 | 830K | |
| thalliumh.htm | 2024-11-28 13:52 | 23K | |